C19H19NO2 — CID 102222628
3-benzyl-5-[1-(3-methylphenyl)ethenyl]-1,3-oxazolidin-2-one (PubChem CID 102222628) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-benzyl-5-[1-(3-methylphenyl)ethenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-benzyl-5-[1-(3-methylphenyl)ethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102222628 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-benzyl-5-[1-(3-methylphenyl)ethenyl]-1,3-oxazolidin-2-one |
| SMILES | C=C(c1cccc(C)c1)C1CN(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C19H19NO2/c1-14-7-6-10-17(11-14)15(2)18-13-20(19(21)22-18)12-16-8-4-3-5-9-16/h3-11,18H,2,12-13H2,1H3 |
| InChIKey | FJACXWWUJJKORP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |