C20H27IO4 — CID 102222986
ethyl (2E,4E)-6-[(4R,5R,6S)-6-[(E)-4-iodobut-3-en-1-ynyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-4-methylhexa-2,4-dienoate (PubChem CID 102222986) has the molecular formula C20H27IO4 and a molecular weight of 458.34 g/mol. Its IUPAC name is ethyl (2E,4E)-6-[(4R,5R,6S)-6-[(E)-4-iodobut-3-en-1-ynyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-4-methylhexa-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-6-[(4R,5R,6S)-6-[(E)-4-iodobut-3-en-1-ynyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-4-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 102222986 |
| Molecular Formula | C20H27IO4 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | ethyl (2E,4E)-6-[(4R,5R,6S)-6-[(E)-4-iodobut-3-en-1-ynyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-4-methylhexa-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(C)=C/C[C@H]1OC(C)(C)O[C@H](C#C/C=C/I)[C@@H]1C |
| InChI | InChI=1S/C20H27IO4/c1-6-23-19(22)13-11-15(2)10-12-18-16(3)17(9-7-8-14-21)24-20(4,5)25-18/h8,10-11,13-14,16-18H,6,12H2,1-5H3/b13-11+,14-8+,15-10+/t16-,17+,18+/m0/s1 |
| InChIKey | FBGFGAJLDDLDAU-WDDWIWBYSA-N |
| XLogP | 4.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|