C8H12O4 — CID 102223088
(3R,4S,6S)-3-hydroxy-3,4,6-trimethyloxane-2,5-dione (PubChem CID 102223088) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (3R,4S,6S)-3-hydroxy-3,4,6-trimethyloxane-2,5-dione.
| Compound Name | (3R,4S,6S)-3-hydroxy-3,4,6-trimethyloxane-2,5-dione |
|---|---|
| PubChem CID | 102223088 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (3R,4S,6S)-3-hydroxy-3,4,6-trimethyloxane-2,5-dione |
| SMILES | C[C@@H]1OC(=O)[C@](C)(O)[C@H](C)C1=O |
| InChI | InChI=1S/C8H12O4/c1-4-6(9)5(2)12-7(10)8(4,3)11/h4-5,11H,1-3H3/t4-,5+,8-/m1/s1 |
| InChIKey | ROHFHCFJGJHZLX-GLDDHUGJSA-N |
| XLogP | -0.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |