C20H33N5O5 — CID 102223413
methyl (3R,4S,5R,6R)-4-acetamido-6-azido-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pentan-3-ylcyclohexene-1-carboxylate (PubChem CID 102223413) has the molecular formula C20H33N5O5 and a molecular weight of 423.51 g/mol. Its IUPAC name is methyl (3R,4S,5R,6R)-4-acetamido-6-azido-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pentan-3-ylcyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4S,5R,6R)-4-acetamido-6-azido-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pentan-3-ylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 102223413 |
| Molecular Formula | C20H33N5O5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | methyl (3R,4S,5R,6R)-4-acetamido-6-azido-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pentan-3-ylcyclohexene-1-carboxylate |
| SMILES | CCC(CC)[C@@H]1C=C(C(=O)OC)[C@@H](N=[N+]=[N-])[C@H](NC(=O)OC(C)(C)C)[C@H]1NC(C)=O |
| InChI | InChI=1S/C20H33N5O5/c1-8-12(9-2)13-10-14(18(27)29-7)16(24-25-21)17(15(13)22-11(3)26)23-19(28)30-20(4,5)6/h10,12-13,15-17H,8-9H2,1-7H3,(H,22,26)(H,23,28)/t13-,15-,16+,17+/m0/s1 |
| InChIKey | YPDPLVJEQWBGRF-QMCVQRASSA-N |
| XLogP | 3.23 |
| TPSA | 142.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|