C18H27F3O6 — CID 10222359
2-[[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethanol (PubChem CID 10222359) has the molecular formula C18H27F3O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-[[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethanol.
| Compound Name | 2-[[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethanol |
|---|---|
| PubChem CID | 10222359 |
| Molecular Formula | C18H27F3O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-[[(1S,4S,5R,8S,9R,10R,12R)-1,5,9-trimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethanol |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)[C@](OCCO)(C(F)(F)F)O[C@@H]3O[C@]4(C)CCC1C32OO4 |
| InChI | InChI=1S/C18H27F3O6/c1-10-4-5-13-11(2)17(18(19,20)21,23-9-8-22)25-14-16(13)12(10)6-7-15(3,24-14)26-27-16/h10-14,22H,4-9H2,1-3H3/t10-,11-,12?,13+,14+,15+,16?,17-/m1/s1 |
| InChIKey | QYMCLAXZSAPUBM-FBURXMAUSA-N |
| XLogP | 3.14 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|