About 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde
3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde (PubChem CID 102223725) has the molecular formula C15H7F3OS2
and a molecular weight of 324.35 g/mol. Its IUPAC name is 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde.
Molecular Properties
| Compound Name | 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde |
| PubChem CID | 102223725 |
| Molecular Formula | C15H7F3OS2 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde |
| SMILES | O=Cc1c(-c2cccs2)c(F)c(F)c(F)c1-c1cccs1 |
| InChI | InChI=1S/C15H7F3OS2/c16-13-11(9-3-1-5-20-9)8(7-19)12(14(17)15(13)18)10-4-2-6-21-10/h1-7H |
| InChIKey | VVBUYHZTSFGVSZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde?
The IUPAC name of 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde (CID 102223725) is 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde.
What is the SMILES notation for 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde?
The canonical SMILES for 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde is O=Cc1c(-c2cccs2)c(F)c(F)c(F)c1-c1cccs1.
What is the InChIKey of 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde?
The InChIKey is VVBUYHZTSFGVSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7F3OS2/c16-13-11(9-3-1-5-20-9)8(7-19)12(14(17)15(13)18)10-4-2-6-21-10/h1-7H.
What are the key properties of 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde?
3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde has a molecular weight of 324.35 g/mol, XLogP of 5.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trifluoro-2,6-dithiophen-2-ylbenzaldehyde is sourced from PubChem (CID 102223725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).