C23H40F3NO5SSi3 — CID 102223973
2,2,2-trifluoro-N-[(2S,3R,4R,5R,6R)-2-phenylsulfanyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide (PubChem CID 102223973) has the molecular formula C23H40F3NO5SSi3 and a molecular weight of 583.89 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2S,3R,4R,5R,6R)-2-phenylsulfanyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2S,3R,4R,5R,6R)-2-phenylsulfanyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 102223973 |
| Molecular Formula | C23H40F3NO5SSi3 |
| Molecular Weight | 583.89 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2S,3R,4R,5R,6R)-2-phenylsulfanyl-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide |
| SMILES | C[Si](C)(C)OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](NC(=O)C(F)(F)F)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C23H40F3NO5SSi3/c1-34(2,3)29-15-17-19(31-35(4,5)6)20(32-36(7,8)9)18(27-22(28)23(24,25)26)21(30-17)33-16-13-11-10-12-14-16/h10-14,17-21H,15H2,1-9H3,(H,27,28)/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | MFZMHQFVEJCMNJ-ONUIULTDSA-N |
| XLogP | 5.84 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.89 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|