C16H22F3NO3S2 — CID 10222449
(3R,5S)-1-butylsulfonyl-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol (PubChem CID 10222449) has the molecular formula C16H22F3NO3S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is (3R,5S)-1-butylsulfonyl-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol.
| Compound Name | (3R,5S)-1-butylsulfonyl-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol |
|---|---|
| PubChem CID | 10222449 |
| Molecular Formula | C16H22F3NO3S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (3R,5S)-1-butylsulfonyl-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol |
| SMILES | CCCCS(=O)(=O)N1C[C@H](S)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H22F3NO3S2/c1-2-3-4-25(21,22)20-8-13(24)6-12(20)10-23-9-11-5-15(18)16(19)7-14(11)17/h5,7,12-13,24H,2-4,6,8-10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | UPLTZPIJESBBNA-QWHCGFSZSA-N |
| XLogP | 3.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|