C22H39NO5 — CID 10222470
1-(3-hexyl-4-oxooxetan-2-yl)heptan-2-yl 2-formamido-3-methylbutanoate (PubChem CID 10222470) has the molecular formula C22H39NO5 and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-(3-hexyl-4-oxooxetan-2-yl)heptan-2-yl 2-formamido-3-methylbutanoate.
| Compound Name | 1-(3-hexyl-4-oxooxetan-2-yl)heptan-2-yl 2-formamido-3-methylbutanoate |
|---|---|
| PubChem CID | 10222470 |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | 1-(3-hexyl-4-oxooxetan-2-yl)heptan-2-yl 2-formamido-3-methylbutanoate |
| SMILES | CCCCCCC1C(=O)OC1CC(CCCCC)OC(=O)C(NC=O)C(C)C |
| InChI | InChI=1S/C22H39NO5/c1-5-7-9-11-13-18-19(28-21(18)25)14-17(12-10-8-6-2)27-22(26)20(16(3)4)23-15-24/h15-20H,5-14H2,1-4H3,(H,23,24) |
| InChIKey | WWGVIIVMPMBQFV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|