C23H38O4Si — CID 102224771
(4S,5aR,6S,9aS,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7,9b-dimethyl-4,5,5a,6,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-2-one (PubChem CID 102224771) has the molecular formula C23H38O4Si and a molecular weight of 406.64 g/mol. Its IUPAC name is (4S,5aR,6S,9aS,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7,9b-dimethyl-4,5,5a,6,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-2-one.
| Compound Name | (4S,5aR,6S,9aS,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7,9b-dimethyl-4,5,5a,6,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-2-one |
|---|---|
| PubChem CID | 102224771 |
| Molecular Formula | C23H38O4Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (4S,5aR,6S,9aS,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7,9b-dimethyl-4,5,5a,6,9,9a-hexahydro-1H-cyclopenta[a]naphthalen-2-one |
| SMILES | COCO[C@@H]1C(C)=CC[C@H]2[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C1=CC(=O)C[C@@]12C |
| InChI | InChI=1S/C23H38O4Si/c1-15-9-10-18-17(21(15)26-14-25-6)12-20(27-28(7,8)22(2,3)4)19-11-16(24)13-23(18,19)5/h9,11,17-18,20-21H,10,12-14H2,1-8H3/t17-,18+,20+,21-,23-/m1/s1 |
| InChIKey | FHWAWGLZORCNAC-VQHDKVTMSA-N |
| XLogP | 5.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|