C17H10F9NO2S — CID 102224997
N-(9H-fluoren-9-yl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 102224997) has the molecular formula C17H10F9NO2S and a molecular weight of 463.32 g/mol. Its IUPAC name is N-(9H-fluoren-9-yl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N-(9H-fluoren-9-yl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 102224997 |
| Molecular Formula | C17H10F9NO2S |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | N-(9H-fluoren-9-yl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(NC1c2ccccc2-c2ccccc21)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H10F9NO2S/c18-14(19,16(22,23)24)15(20,21)17(25,26)30(28,29)27-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13,27H |
| InChIKey | OKVMPJLVUQKHCA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|