C12H16F9NO2S — CID 102225000
N-cyclooctyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 102225000) has the molecular formula C12H16F9NO2S and a molecular weight of 409.31 g/mol. Its IUPAC name is N-cyclooctyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N-cyclooctyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 102225000 |
| Molecular Formula | C12H16F9NO2S |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-cyclooctyl-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(NC1CCCCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H16F9NO2S/c13-9(14,11(17,18)19)10(15,16)12(20,21)25(23,24)22-8-6-4-2-1-3-5-7-8/h8,22H,1-7H2 |
| InChIKey | IQHFWDNZUPFZQI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|