C24H28O5 — CID 102225151
1,4-dimethoxy-2-(2,4,6-triethoxyphenyl)naphthalene (PubChem CID 102225151) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is 1,4-dimethoxy-2-(2,4,6-triethoxyphenyl)naphthalene.
| Compound Name | 1,4-dimethoxy-2-(2,4,6-triethoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 102225151 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 1,4-dimethoxy-2-(2,4,6-triethoxyphenyl)naphthalene |
| SMILES | CCOc1cc(OCC)c(-c2cc(OC)c3ccccc3c2OC)c(OCC)c1 |
| InChI | InChI=1S/C24H28O5/c1-6-27-16-13-21(28-7-2)23(22(14-16)29-8-3)19-15-20(25-4)17-11-9-10-12-18(17)24(19)26-5/h9-15H,6-8H2,1-5H3 |
| InChIKey | JYTSJIPLJHVQOG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |