C18H14N4O3S2 — CID 10222518
N-ethyl-4-(3-oxo-1,2-oxazol-5-yl)-N-(2-sulfanylidene-1H-[1,3]thiazolo[5,4-b]pyridin-5-yl)benzamide (PubChem CID 10222518) has the molecular formula C18H14N4O3S2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N-ethyl-4-(3-oxo-1,2-oxazol-5-yl)-N-(2-sulfanylidene-1H-[1,3]thiazolo[5,4-b]pyridin-5-yl)benzamide.
| Compound Name | N-ethyl-4-(3-oxo-1,2-oxazol-5-yl)-N-(2-sulfanylidene-1H-[1,3]thiazolo[5,4-b]pyridin-5-yl)benzamide |
|---|---|
| PubChem CID | 10222518 |
| Molecular Formula | C18H14N4O3S2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N-ethyl-4-(3-oxo-1,2-oxazol-5-yl)-N-(2-sulfanylidene-1H-[1,3]thiazolo[5,4-b]pyridin-5-yl)benzamide |
| SMILES | CCN(C(=O)c1ccc(-c2cc(=O)[nH]o2)cc1)c1ccc2[nH]c(=S)sc2n1 |
| InChI | InChI=1S/C18H14N4O3S2/c1-2-22(14-8-7-12-16(20-14)27-18(26)19-12)17(24)11-5-3-10(4-6-11)13-9-15(23)21-25-13/h3-9H,2H2,1H3,(H,19,26)(H,21,23) |
| InChIKey | YJOFRAHXLKGNKX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|