C17H22N2O3S — CID 102225196
2-cyclohexyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one (PubChem CID 102225196) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-cyclohexyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one.
| Compound Name | 2-cyclohexyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 102225196 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-cyclohexyl-1-(4-methylphenyl)sulfonyl-4,5-dihydropyrimidin-6-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)CCN=C2C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H22N2O3S/c1-13-7-9-15(10-8-13)23(21,22)19-16(20)11-12-18-17(19)14-5-3-2-4-6-14/h7-10,14H,2-6,11-12H2,1H3 |
| InChIKey | ZWSRXALSIRIFJK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |