C32H30N2 — CID 102225342
1-N,1-N,8-N,8-N-tetramethyl-2,7-bis[2-(4-methylphenyl)ethynyl]naphthalene-1,8-diamine (PubChem CID 102225342) has the molecular formula C32H30N2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 1-N,1-N,8-N,8-N-tetramethyl-2,7-bis[2-(4-methylphenyl)ethynyl]naphthalene-1,8-diamine.
| Compound Name | 1-N,1-N,8-N,8-N-tetramethyl-2,7-bis[2-(4-methylphenyl)ethynyl]naphthalene-1,8-diamine |
|---|---|
| PubChem CID | 102225342 |
| Molecular Formula | C32H30N2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-N,1-N,8-N,8-N-tetramethyl-2,7-bis[2-(4-methylphenyl)ethynyl]naphthalene-1,8-diamine |
| SMILES | Cc1ccc(C#Cc2ccc3ccc(C#Cc4ccc(C)cc4)c(N(C)C)c3c2N(C)C)cc1 |
| InChI | InChI=1S/C32H30N2/c1-23-7-11-25(12-8-23)15-17-28-21-19-27-20-22-29(18-16-26-13-9-24(2)10-14-26)32(34(5)6)30(27)31(28)33(3)4/h7-14,19-22H,1-6H3 |
| InChIKey | SQAHXTZOBKPAIL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|