C32H12F6O10 — CID 102225464
[4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 102225464) has the molecular formula C32H12F6O10 and a molecular weight of 670.43 g/mol. Its IUPAC name is [4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 102225464 |
| Molecular Formula | C32H12F6O10 |
| Molecular Weight | 670.43 g/mol |
| Exact Mass | 670.03 |
| IUPAC Name | [4-[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(Oc1ccc(-c2ccc(OC(=O)c3ccc4c(c3)C(=O)OC4=O)cc2C(F)(F)F)c(C(F)(F)F)c1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C32H12F6O10/c33-31(34,35)23-11-15(45-25(39)13-1-5-19-21(9-13)29(43)47-27(19)41)3-7-17(23)18-8-4-16(12-24(18)32(36,37)38)46-26(40)14-2-6-20-22(10-14)30(44)48-28(20)42/h1-12H |
| InChIKey | LPOFMBDHGZJELA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.43 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|