C23H16N2O3S — CID 1022255
13-acetyl-14-amino-16-(4-methoxyphenyl)-12-thia-10-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,13,15-heptaen-8-one (PubChem CID 1022255) has the molecular formula C23H16N2O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is 13-acetyl-14-amino-16-(4-methoxyphenyl)-12-thia-10-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,13,15-heptaen-8-one.
| Compound Name | 13-acetyl-14-amino-16-(4-methoxyphenyl)-12-thia-10-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,13,15-heptaen-8-one |
|---|---|
| PubChem CID | 1022255 |
| Molecular Formula | C23H16N2O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 13-acetyl-14-amino-16-(4-methoxyphenyl)-12-thia-10-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,10,13,15-heptaen-8-one |
| SMILES | COc1ccc(-c2c3c(nc4sc(C(C)=O)c(N)c24)C(=O)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C23H16N2O3S/c1-11(26)22-19(24)18-16(12-7-9-13(28-2)10-8-12)17-14-5-3-4-6-15(14)21(27)20(17)25-23(18)29-22/h3-10H,24H2,1-2H3 |
| InChIKey | JREHJOBLBPMYOU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |