About tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane
tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane (PubChem CID 102225707) has the molecular formula C16H32O2Si
and a molecular weight of 284.52 g/mol. Its IUPAC name is tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane |
| PubChem CID | 102225707 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane |
| SMILES | CCCC/C=C/C=C(\OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O2Si/c1-8-10-11-12-13-14-15(17-9-2)18-19(6,7)16(3,4)5/h12-14H,8-11H2,1-7H3/b13-12+,15-14+ |
| InChIKey | SBMNEVFVWXMILF-SQIWNDBBSA-N |
| XLogP | 5.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane (CID 102225707) is tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane is CCCC/C=C/C=C(\OCC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane?
The InChIKey is SBMNEVFVWXMILF-SQIWNDBBSA-N. The full InChI is InChI=1S/C16H32O2Si/c1-8-10-11-12-13-14-15(17-9-2)18-19(6,7)16(3,4)5/h12-14H,8-11H2,1-7H3/b13-12+,15-14+.
What are the key properties of tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane?
tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane has a molecular weight of 284.52 g/mol, XLogP of 5.63, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1E,3E)-1-ethoxyocta-1,3-dienoxy]-dimethylsilane is sourced from PubChem (CID 102225707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).