C30H39N4O3P — CID 102225818
2,8,9-tris[(3-methoxyphenyl)methyl]-2,5,8,9-tetraza-1-phosphabicyclo[3.3.3]undecane (PubChem CID 102225818) has the molecular formula C30H39N4O3P and a molecular weight of 534.64 g/mol. Its IUPAC name is 2,8,9-tris[(3-methoxyphenyl)methyl]-2,5,8,9-tetraza-1-phosphabicyclo[3.3.3]undecane.
| Compound Name | 2,8,9-tris[(3-methoxyphenyl)methyl]-2,5,8,9-tetraza-1-phosphabicyclo[3.3.3]undecane |
|---|---|
| PubChem CID | 102225818 |
| Molecular Formula | C30H39N4O3P |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 2,8,9-tris[(3-methoxyphenyl)methyl]-2,5,8,9-tetraza-1-phosphabicyclo[3.3.3]undecane |
| SMILES | COc1cccc(CN2CCN3CCN(Cc4cccc(OC)c4)P2N(Cc2cccc(OC)c2)CC3)c1 |
| InChI | InChI=1S/C30H39N4O3P/c1-35-28-10-4-7-25(19-28)22-32-16-13-31-14-17-33(23-26-8-5-11-29(20-26)36-2)38(32)34(18-15-31)24-27-9-6-12-30(21-27)37-3/h4-12,19-21H,13-18,22-24H2,1-3H3 |
| InChIKey | KUWRTTWMLCAQLY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 40.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|