About (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile
(2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile (PubChem CID 102225965) has the molecular formula C22H20N2O
and a molecular weight of 328.42 g/mol. Its IUPAC name is (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile.
Molecular Properties
| Compound Name | (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile |
| PubChem CID | 102225965 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile |
| SMILES | CC(C)(C)C(=O)/C(C#N)=C/c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H20N2O/c1-22(2,3)21(25)16(14-23)13-18-17-11-7-8-12-19(17)24-20(18)15-9-5-4-6-10-15/h4-13,24H,1-3H3/b16-13+ |
| InChIKey | RJTHZKKXOLJADM-DTQAZKPQSA-N |
| XLogP | 5.36 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile?
The IUPAC name of (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile (CID 102225965) is (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile.
What is the SMILES notation for (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile?
The canonical SMILES for (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile is CC(C)(C)C(=O)/C(C#N)=C/c1c(-c2ccccc2)[nH]c2ccccc12.
What is the InChIKey of (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile?
The InChIKey is RJTHZKKXOLJADM-DTQAZKPQSA-N. The full InChI is InChI=1S/C22H20N2O/c1-22(2,3)21(25)16(14-23)13-18-17-11-7-8-12-19(17)24-20(18)15-9-5-4-6-10-15/h4-13,24H,1-3H3/b16-13+.
What are the key properties of (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile?
(2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile has a molecular weight of 328.42 g/mol, XLogP of 5.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4,4-dimethyl-3-oxo-2-[(2-phenyl-1H-indol-3-yl)methylidene]pentanenitrile is sourced from PubChem (CID 102225965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).