C12H13NO3 — CID 102226426
(2S,3E,5E)-1-nitro-6-phenylhexa-3,5-dien-2-ol (PubChem CID 102226426) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2S,3E,5E)-1-nitro-6-phenylhexa-3,5-dien-2-ol.
| Compound Name | (2S,3E,5E)-1-nitro-6-phenylhexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 102226426 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2S,3E,5E)-1-nitro-6-phenylhexa-3,5-dien-2-ol |
| SMILES | O=[N+]([O-])C[C@@H](O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H13NO3/c14-12(10-13(15)16)9-5-4-8-11-6-2-1-3-7-11/h1-9,12,14H,10H2/b8-4+,9-5+/t12-/m0/s1 |
| InChIKey | DBDKRVDENOHCKS-AFCBDNRUSA-N |
| XLogP | 1.89 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|