About 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid
4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid (PubChem CID 102227056) has the molecular formula C47H53NO4S
and a molecular weight of 728.01 g/mol. Its IUPAC name is 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid |
| PubChem CID | 102227056 |
| Molecular Formula | C47H53NO4S |
| Molecular Weight | 728.01 g/mol |
| Exact Mass | 727.37 |
| IUPAC Name | 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid |
| SMILES | CCCCC(CC)COc1ccc(-c2ccc3c(c2)Sc2cc(-c4ccc(OCC(CC)CCCC)cc4)ccc2N3c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C47H53NO4S/c1-5-9-11-33(7-3)31-51-41-23-15-35(16-24-41)38-19-27-43-45(29-38)53-46-30-39(20-28-44(46)48(43)40-21-13-37(14-22-40)47(49)50)36-17-25-42(26-18-36)52-32-34(8-4)12-10-6-2/h13-30,33-34H,5-12,31-32H2,1-4H3,(H,49,50) |
| InChIKey | CCTURRICXZNZCI-UHFFFAOYSA-N |
| XLogP | 13.84 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 728.01 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid?
The IUPAC name of 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid (CID 102227056) is 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid.
What is the SMILES notation for 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid?
The canonical SMILES for 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid is CCCCC(CC)COc1ccc(-c2ccc3c(c2)Sc2cc(-c4ccc(OCC(CC)CCCC)cc4)ccc2N3c2ccc(C(=O)O)cc2)cc1.
What is the InChIKey of 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid?
The InChIKey is CCTURRICXZNZCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C47H53NO4S/c1-5-9-11-33(7-3)31-51-41-23-15-35(16-24-41)38-19-27-43-45(29-38)53-46-30-39(20-28-44(46)48(43)40-21-13-37(14-22-40)47(49)50)36-17-25-42(26-18-36)52-32-34(8-4)12-10-6-2/h13-30,33-34H,5-12,31-32H2,1-4H3,(H,49,50).
What are the key properties of 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid?
4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid has a molecular weight of 728.01 g/mol, XLogP of 13.84, 18 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]benzoic acid is sourced from PubChem (CID 102227056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).