About 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid
4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid (PubChem CID 102227057) has the molecular formula C53H57NO4S
and a molecular weight of 804.11 g/mol. Its IUPAC name is 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid |
| PubChem CID | 102227057 |
| Molecular Formula | C53H57NO4S |
| Molecular Weight | 804.11 g/mol |
| Exact Mass | 803.40 |
| IUPAC Name | 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid |
| SMILES | CCCCC(CC)COc1ccc(-c2ccc3c(c2)Sc2cc(-c4ccc(OCC(CC)CCCC)cc4)ccc2N3c2ccc(-c3ccc(C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C53H57NO4S/c1-5-9-11-37(7-3)35-57-47-27-19-41(20-28-47)44-23-31-49-51(33-44)59-52-34-45(42-21-29-48(30-22-42)58-36-38(8-4)12-10-6-2)24-32-50(52)54(49)46-25-17-40(18-26-46)39-13-15-43(16-14-39)53(55)56/h13-34,37-38H,5-12,35-36H2,1-4H3,(H,55,56) |
| InChIKey | AOSLKQXHDLIGFK-UHFFFAOYSA-N |
| XLogP | 15.51 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 804.11 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid?
The IUPAC name of 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid (CID 102227057) is 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid.
What is the SMILES notation for 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid?
The canonical SMILES for 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid is CCCCC(CC)COc1ccc(-c2ccc3c(c2)Sc2cc(-c4ccc(OCC(CC)CCCC)cc4)ccc2N3c2ccc(-c3ccc(C(=O)O)cc3)cc2)cc1.
What is the InChIKey of 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid?
The InChIKey is AOSLKQXHDLIGFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C53H57NO4S/c1-5-9-11-37(7-3)35-57-47-27-19-41(20-28-47)44-23-31-49-51(33-44)59-52-34-45(42-21-29-48(30-22-42)58-36-38(8-4)12-10-6-2)24-32-50(52)54(49)46-25-17-40(18-26-46)39-13-15-43(16-14-39)53(55)56/h13-34,37-38H,5-12,35-36H2,1-4H3,(H,55,56).
What are the key properties of 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid?
4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid has a molecular weight of 804.11 g/mol, XLogP of 15.51, 19 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[3,7-bis[4-(2-ethylhexoxy)phenyl]phenothiazin-10-yl]phenyl]benzoic acid is sourced from PubChem (CID 102227057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).