C13H22O5 — CID 102227123
(2R,4S,5S,6E,8S)-4,5-dihydroxy-8-methoxy-2-propyl-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 102227123) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (2R,4S,5S,6E,8S)-4,5-dihydroxy-8-methoxy-2-propyl-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,4S,5S,6E,8S)-4,5-dihydroxy-8-methoxy-2-propyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 102227123 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (2R,4S,5S,6E,8S)-4,5-dihydroxy-8-methoxy-2-propyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | CCC[C@@H]1C[C@H](O)[C@@H](O)/C=C/[C@@H](OC)CC(=O)O1 |
| InChI | InChI=1S/C13H22O5/c1-3-4-10-7-12(15)11(14)6-5-9(17-2)8-13(16)18-10/h5-6,9-12,14-15H,3-4,7-8H2,1-2H3/b6-5+/t9-,10-,11+,12+/m1/s1 |
| InChIKey | TZYNNKFLVAMHEW-RNKUOQLFSA-N |
| XLogP | 0.79 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|