C18H26N8 — CID 102227135
1-[6-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)pyrimidin-4-yl]-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidine (PubChem CID 102227135) has the molecular formula C18H26N8 and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-[6-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)pyrimidin-4-yl]-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidine.
| Compound Name | 1-[6-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)pyrimidin-4-yl]-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 102227135 |
| Molecular Formula | C18H26N8 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-[6-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)pyrimidin-4-yl]-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidine |
| SMILES | c1nc(N2CCCN3CCCN=C32)cc(N2CCCN3CCCN=C32)n1 |
| InChI | InChI=1S/C18H26N8/c1-5-19-17-23(7-1)9-3-11-25(17)15-13-16(22-14-21-15)26-12-4-10-24-8-2-6-20-18(24)26/h13-14H,1-12H2 |
| InChIKey | LQAHGZXQZXOKMV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 63.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |