About 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate
4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate (PubChem CID 10222714) has the molecular formula C23H28ClNO3
and a molecular weight of 401.93 g/mol. Its IUPAC name is 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate.
Molecular Properties
| Compound Name | 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate |
| PubChem CID | 10222714 |
| Molecular Formula | C23H28ClNO3 |
| Molecular Weight | 401.93 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate |
| SMILES | O=C(OCCCCN1CCC(OCc2ccccc2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H28ClNO3/c24-21-10-6-9-20(17-21)23(26)27-16-5-4-13-25-14-11-22(12-15-25)28-18-19-7-2-1-3-8-19/h1-3,6-10,17,22H,4-5,11-16,18H2 |
| InChIKey | NDGPQNPYSUGIAY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.93 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate?
The IUPAC name of 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate (CID 10222714) is 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate.
What is the SMILES notation for 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate?
The canonical SMILES for 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate is O=C(OCCCCN1CCC(OCc2ccccc2)CC1)c1cccc(Cl)c1.
What is the InChIKey of 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate?
The InChIKey is NDGPQNPYSUGIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28ClNO3/c24-21-10-6-9-20(17-21)23(26)27-16-5-4-13-25-14-11-22(12-15-25)28-18-19-7-2-1-3-8-19/h1-3,6-10,17,22H,4-5,11-16,18H2.
What are the key properties of 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate?
4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate has a molecular weight of 401.93 g/mol, XLogP of 4.96, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-phenylmethoxypiperidin-1-yl)butyl 3-chlorobenzoate is sourced from PubChem (CID 10222714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).