C13H19F3O3 — CID 102227142
5-butyl-4-methoxy-4-(2,2,2-trifluoroethoxy)cyclohex-2-en-1-one (PubChem CID 102227142) has the molecular formula C13H19F3O3 and a molecular weight of 280.29 g/mol. Its IUPAC name is 5-butyl-4-methoxy-4-(2,2,2-trifluoroethoxy)cyclohex-2-en-1-one.
| Compound Name | 5-butyl-4-methoxy-4-(2,2,2-trifluoroethoxy)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 102227142 |
| Molecular Formula | C13H19F3O3 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 5-butyl-4-methoxy-4-(2,2,2-trifluoroethoxy)cyclohex-2-en-1-one |
| SMILES | CCCCC1CC(=O)C=CC1(OC)OCC(F)(F)F |
| InChI | InChI=1S/C13H19F3O3/c1-3-4-5-10-8-11(17)6-7-12(10,18-2)19-9-13(14,15)16/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | SVDNQFBGYPNIIY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|