About 2,6-bis(ethenyl)anthracene
2,6-bis(ethenyl)anthracene (PubChem CID 102227749) has the molecular formula C18H14
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2,6-bis(ethenyl)anthracene.
Molecular Properties
| Compound Name | 2,6-bis(ethenyl)anthracene |
| PubChem CID | 102227749 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2,6-bis(ethenyl)anthracene |
| SMILES | C=Cc1ccc2cc3cc(C=C)ccc3cc2c1 |
| InChI | InChI=1S/C18H14/c1-3-13-5-7-15-12-18-10-14(4-2)6-8-16(18)11-17(15)9-13/h3-12H,1-2H2 |
| InChIKey | IVMQGAAXFSYEQZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(ethenyl)anthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(ethenyl)anthracene?
The IUPAC name of 2,6-bis(ethenyl)anthracene (CID 102227749) is 2,6-bis(ethenyl)anthracene.
What is the SMILES notation for 2,6-bis(ethenyl)anthracene?
The canonical SMILES for 2,6-bis(ethenyl)anthracene is C=Cc1ccc2cc3cc(C=C)ccc3cc2c1.
What is the InChIKey of 2,6-bis(ethenyl)anthracene?
The InChIKey is IVMQGAAXFSYEQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14/c1-3-13-5-7-15-12-18-10-14(4-2)6-8-16(18)11-17(15)9-13/h3-12H,1-2H2.
What are the key properties of 2,6-bis(ethenyl)anthracene?
2,6-bis(ethenyl)anthracene has a molecular weight of 230.31 g/mol, XLogP of 5.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(ethenyl)anthracene is sourced from PubChem (CID 102227749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).