C15H24O2 — CID 102227830
(3aZ,5R,9R)-5-hydroxy-2,2,5,9-tetramethyl-1,3,7,8,9,9a-hexahydrocyclopenta[8]annulen-6-one (PubChem CID 102227830) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (3aZ,5R,9R)-5-hydroxy-2,2,5,9-tetramethyl-1,3,7,8,9,9a-hexahydrocyclopenta[8]annulen-6-one.
| Compound Name | (3aZ,5R,9R)-5-hydroxy-2,2,5,9-tetramethyl-1,3,7,8,9,9a-hexahydrocyclopenta[8]annulen-6-one |
|---|---|
| PubChem CID | 102227830 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3aZ,5R,9R)-5-hydroxy-2,2,5,9-tetramethyl-1,3,7,8,9,9a-hexahydrocyclopenta[8]annulen-6-one |
| SMILES | C[C@@H]1CCC(=O)[C@](C)(O)/C=C2/CC(C)(C)CC21 |
| InChI | InChI=1S/C15H24O2/c1-10-5-6-13(16)15(4,17)8-11-7-14(2,3)9-12(10)11/h8,10,12,17H,5-7,9H2,1-4H3/b11-8-/t10-,12?,15-/m1/s1 |
| InChIKey | OAXGQQKOWZKFRJ-BMQDVXNGSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|