C18H13N3 — CID 102228055
3,7-diphenyltriazolo[1,5-a]pyridine (PubChem CID 102228055) has the molecular formula C18H13N3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3,7-diphenyltriazolo[1,5-a]pyridine.
| Compound Name | 3,7-diphenyltriazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 102228055 |
| Molecular Formula | C18H13N3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3,7-diphenyltriazolo[1,5-a]pyridine |
| SMILES | c1ccc(-c2nnn3c(-c4ccccc4)cccc23)cc1 |
| InChI | InChI=1S/C18H13N3/c1-3-8-14(9-4-1)16-12-7-13-17-18(19-20-21(16)17)15-10-5-2-6-11-15/h1-13H |
| InChIKey | COVXUDRYUAKXLG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |