About (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol
(E)-1,1,1-trichloro-5-methylhex-3-en-2-ol (PubChem CID 102228083) has the molecular formula C7H11Cl3O
and a molecular weight of 217.52 g/mol. Its IUPAC name is (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol |
| PubChem CID | 102228083 |
| Molecular Formula | C7H11Cl3O |
| Molecular Weight | 217.52 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol |
| SMILES | CC(C)/C=C/C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H11Cl3O/c1-5(2)3-4-6(11)7(8,9)10/h3-6,11H,1-2H3/b4-3+ |
| InChIKey | OCYKESOIPVUYAT-ONEGZZNKSA-N |
| XLogP | 2.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol?
The IUPAC name of (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol (CID 102228083) is (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol.
What is the SMILES notation for (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol?
The canonical SMILES for (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol is CC(C)/C=C/C(O)C(Cl)(Cl)Cl.
What is the InChIKey of (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol?
The InChIKey is OCYKESOIPVUYAT-ONEGZZNKSA-N. The full InChI is InChI=1S/C7H11Cl3O/c1-5(2)3-4-6(11)7(8,9)10/h3-6,11H,1-2H3/b4-3+.
What are the key properties of (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol?
(E)-1,1,1-trichloro-5-methylhex-3-en-2-ol has a molecular weight of 217.52 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1,1-trichloro-5-methylhex-3-en-2-ol is sourced from PubChem (CID 102228083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).