C19H15N3O2S — CID 102228148
(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]-[1,3]thiazolo[3,2-a]quinazoline-1,5-dione (PubChem CID 102228148) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is (2Z)-2-[[4-(dimethylamino)phenyl]methylidene]-[1,3]thiazolo[3,2-a]quinazoline-1,5-dione.
| Compound Name | (2Z)-2-[[4-(dimethylamino)phenyl]methylidene]-[1,3]thiazolo[3,2-a]quinazoline-1,5-dione |
|---|---|
| PubChem CID | 102228148 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (2Z)-2-[[4-(dimethylamino)phenyl]methylidene]-[1,3]thiazolo[3,2-a]quinazoline-1,5-dione |
| SMILES | CN(C)c1ccc(/C=c2\sc3nc(=O)c4ccccc4n3c2=O)cc1 |
| InChI | InChI=1S/C19H15N3O2S/c1-21(2)13-9-7-12(8-10-13)11-16-18(24)22-15-6-4-3-5-14(15)17(23)20-19(22)25-16/h3-11H,1-2H3/b16-11- |
| InChIKey | GWQLHHYHHZIRNY-WJDWOHSUSA-N |
| XLogP | 1.88 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|