About (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one
(5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one (PubChem CID 102228196) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one |
| PubChem CID | 102228196 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one |
| SMILES | CN1C/C(=C/CC(C)(C)C)OC1=O |
| InChI | InChI=1S/C10H17NO2/c1-10(2,3)6-5-8-7-11(4)9(12)13-8/h5H,6-7H2,1-4H3/b8-5- |
| InChIKey | JYBJWBFBQYNVKG-YVMONPNESA-N |
| XLogP | 2.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one?
The IUPAC name of (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one (CID 102228196) is (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one?
The canonical SMILES for (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one is CN1C/C(=C/CC(C)(C)C)OC1=O.
What is the InChIKey of (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one?
The InChIKey is JYBJWBFBQYNVKG-YVMONPNESA-N. The full InChI is InChI=1S/C10H17NO2/c1-10(2,3)6-5-8-7-11(4)9(12)13-8/h5H,6-7H2,1-4H3/b8-5-.
What are the key properties of (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one?
(5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one has a molecular weight of 183.25 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-(3,3-dimethylbutylidene)-3-methyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 102228196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).