C16H25N2O5PS — CID 102228703
1-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(5,5-dimethyl-2-oxido-4-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl)thiourea (PubChem CID 102228703) has the molecular formula C16H25N2O5PS and a molecular weight of 388.43 g/mol. Its IUPAC name is 1-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(5,5-dimethyl-2-oxido-4-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl)thiourea.
| Compound Name | 1-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(5,5-dimethyl-2-oxido-4-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl)thiourea |
|---|---|
| PubChem CID | 102228703 |
| Molecular Formula | C16H25N2O5PS |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-(1,3-dihydroxy-2-methylpropan-2-yl)-3-(5,5-dimethyl-2-oxido-4-phenyl-1,3,2-dioxaphosphinan-2-ium-2-yl)thiourea |
| SMILES | CC(CO)(CO)NC(=S)N[P+]1([O-])OCC(C)(C)C(c2ccccc2)O1 |
| InChI | InChI=1S/C16H25N2O5PS/c1-15(2)11-22-24(21,18-14(25)17-16(3,9-19)10-20)23-13(15)12-7-5-4-6-8-12/h4-8,13,19-20H,9-11H2,1-3H3,(H2,17,18,21,25) |
| InChIKey | TUFCEXDLVKKLPN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|