C29H42N2O2 — CID 102228826
2-[[(3aS,7aR)-3-[(5-tert-butyl-2-hydroxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4-tert-butylphenol (PubChem CID 102228826) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 2-[[(3aS,7aR)-3-[(5-tert-butyl-2-hydroxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4-tert-butylphenol.
| Compound Name | 2-[[(3aS,7aR)-3-[(5-tert-butyl-2-hydroxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4-tert-butylphenol |
|---|---|
| PubChem CID | 102228826 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 2-[[(3aS,7aR)-3-[(5-tert-butyl-2-hydroxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl]methyl]-4-tert-butylphenol |
| SMILES | CC(C)(C)c1ccc(O)c(CN2CN(Cc3cc(C(C)(C)C)ccc3O)[C@H]3CCCC[C@H]32)c1 |
| InChI | InChI=1S/C29H42N2O2/c1-28(2,3)22-11-13-26(32)20(15-22)17-30-19-31(25-10-8-7-9-24(25)30)18-21-16-23(29(4,5)6)12-14-27(21)33/h11-16,24-25,32-33H,7-10,17-19H2,1-6H3/t24-,25+ |
| InChIKey | QOBDBXQJKOFDHW-PLQXJYEYSA-N |
| XLogP | 6.28 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|