C17H16O3S — CID 102229087
(4aS,8aR)-2-methoxy-8-phenylsulfanyl-4a,5,8,8a-tetrahydronaphthalene-1,4-dione (PubChem CID 102229087) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is (4aS,8aR)-2-methoxy-8-phenylsulfanyl-4a,5,8,8a-tetrahydronaphthalene-1,4-dione.
| Compound Name | (4aS,8aR)-2-methoxy-8-phenylsulfanyl-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 102229087 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (4aS,8aR)-2-methoxy-8-phenylsulfanyl-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
| SMILES | COC1=CC(=O)[C@H]2CC=CC(Sc3ccccc3)[C@H]2C1=O |
| InChI | InChI=1S/C17H16O3S/c1-20-14-10-13(18)12-8-5-9-15(16(12)17(14)19)21-11-6-3-2-4-7-11/h2-7,9-10,12,15-16H,8H2,1H3/t12-,15?,16+/m1/s1 |
| InChIKey | IMXFJWWMVBLTBD-TYVLWQRCSA-N |
| XLogP | 3.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|