C23H21N3 — CID 102229187
2,6-diphenyl-4-(2-phenylethyl)-1,4-dihydro-1,3,5-triazine (PubChem CID 102229187) has the molecular formula C23H21N3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2,6-diphenyl-4-(2-phenylethyl)-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2,6-diphenyl-4-(2-phenylethyl)-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 102229187 |
| Molecular Formula | C23H21N3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2,6-diphenyl-4-(2-phenylethyl)-1,4-dihydro-1,3,5-triazine |
| SMILES | c1ccc(CCC2N=C(c3ccccc3)NC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C23H21N3/c1-4-10-18(11-5-1)16-17-21-24-22(19-12-6-2-7-13-19)26-23(25-21)20-14-8-3-9-15-20/h1-15,21H,16-17H2,(H,24,25,26) |
| InChIKey | MHNFWIAGIAEXKD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |