C23H21N3O2 — CID 102229188
4-(2,3-dimethoxyphenyl)-2,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 102229188) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-(2,3-dimethoxyphenyl)-2,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-(2,3-dimethoxyphenyl)-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 102229188 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4-(2,3-dimethoxyphenyl)-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | COc1cccc(C2N=C(c3ccccc3)NC(c3ccccc3)=N2)c1OC |
| InChI | InChI=1S/C23H21N3O2/c1-27-19-15-9-14-18(20(19)28-2)23-25-21(16-10-5-3-6-11-16)24-22(26-23)17-12-7-4-8-13-17/h3-15,23H,1-2H3,(H,24,25,26) |
| InChIKey | JOUHGSBMZDYTAW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |