C21H26O8 — CID 10223009
(6Z,12E)-9,10,18-trihydroxy-15,16-dimethoxy-4,13-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 10223009) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is (6Z,12E)-9,10,18-trihydroxy-15,16-dimethoxy-4,13-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (6Z,12E)-9,10,18-trihydroxy-15,16-dimethoxy-4,13-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 10223009 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (6Z,12E)-9,10,18-trihydroxy-15,16-dimethoxy-4,13-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | COc1cc(O)c2c(c1OC)/C(C)=C/CC(O)C(O)C(=O)/C=C\CC(C)OC2=O |
| InChI | InChI=1S/C21H26O8/c1-11-8-9-14(23)19(25)13(22)7-5-6-12(2)29-21(26)18-15(24)10-16(27-3)20(28-4)17(11)18/h5,7-8,10,12,14,19,23-25H,6,9H2,1-4H3/b7-5-,11-8+ |
| InChIKey | ZPQLJBANNABHLF-UKJSTWFMSA-N |
| XLogP | 2.00 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |