About 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole
2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole (PubChem CID 102230394) has the molecular formula C28H16Br2Cl2N2
and a molecular weight of 611.16 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole |
| PubChem CID | 102230394 |
| Molecular Formula | C28H16Br2Cl2N2 |
| Molecular Weight | 611.16 g/mol |
| Exact Mass | 607.91 |
| IUPAC Name | 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole |
| SMILES | Clc1cc(Cl)c2[nH]c(-c3ccc(Br)cc3)c(-c3c(-c4ccc(Br)cc4)[nH]c4ccccc34)c2c1 |
| InChI | InChI=1S/C28H16Br2Cl2N2/c29-17-9-5-15(6-10-17)26-24(20-3-1-2-4-23(20)33-26)25-21-13-19(31)14-22(32)28(21)34-27(25)16-7-11-18(30)12-8-16/h1-14,33-34H |
| InChIKey | XKLFRGNMLJAQBL-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 611.16 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole?
The IUPAC name of 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole (CID 102230394) is 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole.
What is the SMILES notation for 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole?
The canonical SMILES for 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole is Clc1cc(Cl)c2[nH]c(-c3ccc(Br)cc3)c(-c3c(-c4ccc(Br)cc4)[nH]c4ccccc34)c2c1.
What is the InChIKey of 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole?
The InChIKey is XKLFRGNMLJAQBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H16Br2Cl2N2/c29-17-9-5-15(6-10-17)26-24(20-3-1-2-4-23(20)33-26)25-21-13-19(31)14-22(32)28(21)34-27(25)16-7-11-18(30)12-8-16/h1-14,33-34H.
What are the key properties of 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole?
2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole has a molecular weight of 611.16 g/mol, XLogP of 10.48, 3 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-3-[2-(4-bromophenyl)-1H-indol-3-yl]-5,7-dichloro-1H-indole is sourced from PubChem (CID 102230394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).