C16H16ClNO — CID 102230471
[(3aR,4S,9bS)-8-chloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-cyclopropylmethanone (PubChem CID 102230471) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is [(3aR,4S,9bS)-8-chloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-cyclopropylmethanone.
| Compound Name | [(3aR,4S,9bS)-8-chloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 102230471 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | [(3aR,4S,9bS)-8-chloro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)[C@H]1Nc2ccc(Cl)cc2[C@H]2C=CC[C@@H]12 |
| InChI | InChI=1S/C16H16ClNO/c17-10-6-7-14-13(8-10)11-2-1-3-12(11)15(18-14)16(19)9-4-5-9/h1-2,6-9,11-12,15,18H,3-5H2/t11-,12+,15-/m0/s1 |
| InChIKey | HKSKUKJGQPFTQZ-ZOWXZIJZSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|