C19H30O2S2Si — CID 102230645
O-butan-2-yl [4-(4-methylphenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate (PubChem CID 102230645) has the molecular formula C19H30O2S2Si and a molecular weight of 382.67 g/mol. Its IUPAC name is O-butan-2-yl [4-(4-methylphenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate.
| Compound Name | O-butan-2-yl [4-(4-methylphenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 102230645 |
| Molecular Formula | C19H30O2S2Si |
| Molecular Weight | 382.67 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | O-butan-2-yl [4-(4-methylphenyl)-4-oxo-1-trimethylsilylbutyl]sulfanylmethanethioate |
| SMILES | CCC(C)OC(=S)SC(CCC(=O)c1ccc(C)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C19H30O2S2Si/c1-7-15(3)21-19(22)23-18(24(4,5)6)13-12-17(20)16-10-8-14(2)9-11-16/h8-11,15,18H,7,12-13H2,1-6H3 |
| InChIKey | MAGZHJBDPHTHJN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.67 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|