C24H20F3N3 — CID 10223084
6-[4-(trifluoromethyl)phenyl]-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide (PubChem CID 10223084) has the molecular formula C24H20F3N3 and a molecular weight of 407.44 g/mol. Its IUPAC name is 6-[4-(trifluoromethyl)phenyl]-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide.
| Compound Name | 6-[4-(trifluoromethyl)phenyl]-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 10223084 |
| Molecular Formula | C24H20F3N3 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 6-[4-(trifluoromethyl)phenyl]-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C1c3ccccc3CC1C(c1ccc(C(F)(F)F)cc1)N2 |
| InChI | InChI=1S/C24H20F3N3/c25-24(26,27)16-8-5-13(6-9-16)22-19-11-14-3-1-2-4-17(14)21(19)18-12-15(23(28)29)7-10-20(18)30-22/h1-10,12,19,21-22,30H,11H2,(H3,28,29) |
| InChIKey | HVGVQFBNHCKQIT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|