C33H25NO2 — CID 102230996
(2Z)-1-(4-methoxyphenyl)-2-(4-methyl-1,2-diphenylcyclopenta[b]indol-3-ylidene)ethanone (PubChem CID 102230996) has the molecular formula C33H25NO2 and a molecular weight of 467.57 g/mol. Its IUPAC name is (2Z)-1-(4-methoxyphenyl)-2-(4-methyl-1,2-diphenylcyclopenta[b]indol-3-ylidene)ethanone.
| Compound Name | (2Z)-1-(4-methoxyphenyl)-2-(4-methyl-1,2-diphenylcyclopenta[b]indol-3-ylidene)ethanone |
|---|---|
| PubChem CID | 102230996 |
| Molecular Formula | C33H25NO2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (2Z)-1-(4-methoxyphenyl)-2-(4-methyl-1,2-diphenylcyclopenta[b]indol-3-ylidene)ethanone |
| SMILES | COc1ccc(C(=O)/C=C2/C(c3ccccc3)=C(c3ccccc3)c3c2n(C)c2ccccc32)cc1 |
| InChI | InChI=1S/C33H25NO2/c1-34-28-16-10-9-15-26(28)32-31(24-13-7-4-8-14-24)30(23-11-5-3-6-12-23)27(33(32)34)21-29(35)22-17-19-25(36-2)20-18-22/h3-21H,1-2H3/b27-21- |
| InChIKey | UGYAAZLCLDXGPV-MEFGMAGPSA-N |
| XLogP | 7.43 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|