C31H26O4S2 — CID 102231191
2-[carboxymethylsulfanyl-[4-(1,2,2-triphenylethenyl)phenyl]methyl]sulfanylacetic acid (PubChem CID 102231191) has the molecular formula C31H26O4S2 and a molecular weight of 526.68 g/mol. Its IUPAC name is 2-[carboxymethylsulfanyl-[4-(1,2,2-triphenylethenyl)phenyl]methyl]sulfanylacetic acid.
| Compound Name | 2-[carboxymethylsulfanyl-[4-(1,2,2-triphenylethenyl)phenyl]methyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 102231191 |
| Molecular Formula | C31H26O4S2 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 2-[carboxymethylsulfanyl-[4-(1,2,2-triphenylethenyl)phenyl]methyl]sulfanylacetic acid |
| SMILES | O=C(O)CSC(SCC(=O)O)c1ccc(C(=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26O4S2/c32-27(33)20-36-31(37-21-28(34)35)26-18-16-25(17-19-26)30(24-14-8-3-9-15-24)29(22-10-4-1-5-11-22)23-12-6-2-7-13-23/h1-19,31H,20-21H2,(H,32,33)(H,34,35) |
| InChIKey | YXBQMRARNHHNPZ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|