C16H27NO3 — CID 102231274
(1R,2S,8S)-1-[(E)-hept-5-enyl]-1-hydroxy-8-(hydroxymethyl)-2-methyl-2,5,6,7-tetrahydropyrrolizin-3-one (PubChem CID 102231274) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (1R,2S,8S)-1-[(E)-hept-5-enyl]-1-hydroxy-8-(hydroxymethyl)-2-methyl-2,5,6,7-tetrahydropyrrolizin-3-one.
| Compound Name | (1R,2S,8S)-1-[(E)-hept-5-enyl]-1-hydroxy-8-(hydroxymethyl)-2-methyl-2,5,6,7-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 102231274 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | (1R,2S,8S)-1-[(E)-hept-5-enyl]-1-hydroxy-8-(hydroxymethyl)-2-methyl-2,5,6,7-tetrahydropyrrolizin-3-one |
| SMILES | C/C=C/CCCC[C@@]1(O)[C@H](C)C(=O)N2CCC[C@@]21CO |
| InChI | InChI=1S/C16H27NO3/c1-3-4-5-6-7-10-16(20)13(2)14(19)17-11-8-9-15(16,17)12-18/h3-4,13,18,20H,5-12H2,1-2H3/b4-3+/t13-,15+,16-/m1/s1 |
| InChIKey | XEJNHBMJNYJKBH-UBPNVYNFSA-N |
| XLogP | 1.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|