C14H18F6N2O5 — CID 10223147
tert-butyl 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]propanoate (PubChem CID 10223147) has the molecular formula C14H18F6N2O5 and a molecular weight of 408.30 g/mol. Its IUPAC name is tert-butyl 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]propanoate.
| Compound Name | tert-butyl 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 10223147 |
| Molecular Formula | C14H18F6N2O5 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | tert-butyl 3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNC(=O)C1=NOC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H18F6N2O5/c1-11(2,3)26-9(23)4-5-21-10(24)7-6-8(27-22-7)12(25,13(15,16)17)14(18,19)20/h8,25H,4-6H2,1-3H3,(H,21,24) |
| InChIKey | AOVWTRQTTZMVHC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |