About (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one
(2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one (PubChem CID 102231798) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one.
Molecular Properties
| Compound Name | (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one |
| PubChem CID | 102231798 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one |
| SMILES | CCCCC[C@H](CCO)[C@@]1(C)OC(C)=CC1=O |
| InChI | InChI=1S/C14H24O3/c1-4-5-6-7-12(8-9-15)14(3)13(16)10-11(2)17-14/h10,12,15H,4-9H2,1-3H3/t12-,14-/m1/s1 |
| InChIKey | PQJYVXRYWUFHHJ-TZMCWYRMSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one?
The IUPAC name of (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one (CID 102231798) is (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one.
What is the SMILES notation for (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one?
The canonical SMILES for (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one is CCCCC[C@H](CCO)[C@@]1(C)OC(C)=CC1=O.
What is the InChIKey of (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one?
The InChIKey is PQJYVXRYWUFHHJ-TZMCWYRMSA-N. The full InChI is InChI=1S/C14H24O3/c1-4-5-6-7-12(8-9-15)14(3)13(16)10-11(2)17-14/h10,12,15H,4-9H2,1-3H3/t12-,14-/m1/s1.
What are the key properties of (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one?
(2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one has a molecular weight of 240.34 g/mol, XLogP of 2.83, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3R)-1-hydroxyoctan-3-yl]-2,5-dimethylfuran-3-one is sourced from PubChem (CID 102231798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).