C32H30N4O2 — CID 102232157
2-N,9-N-diethyl-2-N,9-N-bis(4-methylphenyl)-1,10-phenanthroline-2,9-dicarboxamide (PubChem CID 102232157) has the molecular formula C32H30N4O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is 2-N,9-N-diethyl-2-N,9-N-bis(4-methylphenyl)-1,10-phenanthroline-2,9-dicarboxamide.
| Compound Name | 2-N,9-N-diethyl-2-N,9-N-bis(4-methylphenyl)-1,10-phenanthroline-2,9-dicarboxamide |
|---|---|
| PubChem CID | 102232157 |
| Molecular Formula | C32H30N4O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 2-N,9-N-diethyl-2-N,9-N-bis(4-methylphenyl)-1,10-phenanthroline-2,9-dicarboxamide |
| SMILES | CCN(C(=O)c1ccc2ccc3ccc(C(=O)N(CC)c4ccc(C)cc4)nc3c2n1)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H30N4O2/c1-5-35(25-15-7-21(3)8-16-25)31(37)27-19-13-23-11-12-24-14-20-28(34-30(24)29(23)33-27)32(38)36(6-2)26-17-9-22(4)10-18-26/h7-20H,5-6H2,1-4H3 |
| InChIKey | FSGXOTSTBMUIOR-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|